C13H19NO7 — CID 176729477
[2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2-hydroxyethyl] N-tert-butylcarbamate (PubChem CID 176729477) has the molecular formula C13H19NO7 and a molecular weight of 301.30 g/mol. Its IUPAC name is [2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2-hydroxyethyl] N-tert-butylcarbamate.
| Compound Name | [2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2-hydroxyethyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 176729477 |
| Molecular Formula | C13H19NO7 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-2-hydroxyethyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC(O)=C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C13H19NO7/c1-12(2,3)14-11(18)19-6-7(15)8-9(16)20-13(4,5)21-10(8)17/h15H,6H2,1-5H3,(H,14,18) |
| InChIKey | WCRFLSUMVNEFBL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|