C23H16Cl2F4N2O2 — CID 147835570
N-[3-[5-(3,5-dichlorocyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-fluorobenzamide (PubChem CID 147835570) has the molecular formula C23H16Cl2F4N2O2 and a molecular weight of 499.29 g/mol. Its IUPAC name is N-[3-[5-(3,5-dichlorocyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-fluorobenzamide.
| Compound Name | N-[3-[5-(3,5-dichlorocyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 147835570 |
| Molecular Formula | C23H16Cl2F4N2O2 |
| Molecular Weight | 499.29 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | N-[3-[5-(3,5-dichlorocyclohexa-1,5-dien-1-yl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cccc(C2=NOC(C3=CC(Cl)CC(Cl)=C3)(C(F)(F)F)C2)c1)c1ccccc1F |
| InChI | InChI=1S/C23H16Cl2F4N2O2/c24-15-9-14(10-16(25)11-15)22(23(27,28)29)12-20(31-33-22)13-4-3-5-17(8-13)30-21(32)18-6-1-2-7-19(18)26/h1-10,15H,11-12H2,(H,30,32) |
| InChIKey | HRXZIVMBKYUAMY-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.29 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|