C8H3Cl3N2 — CID 14783646
2,3,5-trichloroquinoxaline (PubChem CID 14783646) has the molecular formula C8H3Cl3N2 and a molecular weight of 233.49 g/mol. Its IUPAC name is 2,3,5-trichloroquinoxaline.
| Compound Name | 2,3,5-trichloroquinoxaline |
|---|---|
| PubChem CID | 14783646 |
| Molecular Formula | C8H3Cl3N2 |
| Molecular Weight | 233.49 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 2,3,5-trichloroquinoxaline |
| SMILES | Clc1nc2cccc(Cl)c2nc1Cl |
| InChI | InChI=1S/C8H3Cl3N2/c9-4-2-1-3-5-6(4)13-8(11)7(10)12-5/h1-3H |
| InChIKey | FJUXLHCHAWOMEV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |