C21H21BrN2O2 — CID 147846320
benzyl N-[(1S)-1-[4-(4-bromophenyl)-3H-pyrrol-2-yl]ethyl]-N-methylcarbamate (PubChem CID 147846320) has the molecular formula C21H21BrN2O2 and a molecular weight of 413.32 g/mol. Its IUPAC name is benzyl N-[(1S)-1-[4-(4-bromophenyl)-3H-pyrrol-2-yl]ethyl]-N-methylcarbamate.
| Compound Name | benzyl N-[(1S)-1-[4-(4-bromophenyl)-3H-pyrrol-2-yl]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 147846320 |
| Molecular Formula | C21H21BrN2O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | benzyl N-[(1S)-1-[4-(4-bromophenyl)-3H-pyrrol-2-yl]ethyl]-N-methylcarbamate |
| SMILES | C[C@@H](C1=NC=C(c2ccc(Br)cc2)C1)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21BrN2O2/c1-15(24(2)21(25)26-14-16-6-4-3-5-7-16)20-12-18(13-23-20)17-8-10-19(22)11-9-17/h3-11,13,15H,12,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | HTYUGYWGXCWWMJ-HNNXBMFYSA-N |
| XLogP | 5.29 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |