C7H12BrNO2 — CID 147851461
2-bromo-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone (PubChem CID 147851461) has the molecular formula C7H12BrNO2 and a molecular weight of 222.08 g/mol. Its IUPAC name is 2-bromo-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone.
| Compound Name | 2-bromo-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 147851461 |
| Molecular Formula | C7H12BrNO2 |
| Molecular Weight | 222.08 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 2-bromo-1-(2,2-dimethyl-1,3-oxazolidin-3-yl)ethanone |
| SMILES | CC1(C)OCCN1C(=O)CBr |
| InChI | InChI=1S/C7H12BrNO2/c1-7(2)9(3-4-11-7)6(10)5-8/h3-5H2,1-2H3 |
| InChIKey | HUXDDECQZHZVKO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.08 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|