C23H23Cl2FN2O3 — CID 147851677
3-[5-(2,5-dichlorophenyl)-4-fluoro-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one (PubChem CID 147851677) has the molecular formula C23H23Cl2FN2O3 and a molecular weight of 465.35 g/mol. Its IUPAC name is 3-[5-(2,5-dichlorophenyl)-4-fluoro-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[5-(2,5-dichlorophenyl)-4-fluoro-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 147851677 |
| Molecular Formula | C23H23Cl2FN2O3 |
| Molecular Weight | 465.35 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3-[5-(2,5-dichlorophenyl)-4-fluoro-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)CCc2cc(-c3cc(Cl)ccc3Cl)c(F)cc2OC)CC1 |
| InChI | InChI=1S/C23H23Cl2FN2O3/c1-3-22(29)27-8-10-28(11-9-27)23(30)7-4-15-12-18(20(26)14-21(15)31-2)17-13-16(24)5-6-19(17)25/h3,5-6,12-14H,1,4,7-11H2,2H3 |
| InChIKey | HUYCSIMITVLDID-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|