C23H24Cl2N2O3 — CID 161316625
3-[4-chloro-5-(4-chlorophenyl)-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one (PubChem CID 161316625) has the molecular formula C23H24Cl2N2O3 and a molecular weight of 447.36 g/mol. Its IUPAC name is 3-[4-chloro-5-(4-chlorophenyl)-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one.
| Compound Name | 3-[4-chloro-5-(4-chlorophenyl)-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 161316625 |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-[4-chloro-5-(4-chlorophenyl)-2-methoxyphenyl]-1-(4-prop-2-enoylpiperazin-1-yl)propan-1-one |
| SMILES | C=CC(=O)N1CCN(C(=O)CCc2cc(-c3ccc(Cl)cc3)c(Cl)cc2OC)CC1 |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-3-22(28)26-10-12-27(13-11-26)23(29)9-6-17-14-19(20(25)15-21(17)30-2)16-4-7-18(24)8-5-16/h3-5,7-8,14-15H,1,6,9-13H2,2H3 |
| InChIKey | VJOUGKCNKLRENX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|