C23H24Cl2N2O3 — CID 134599273
1-[1-[2-[4-chloro-5-(4-chlorophenyl)-2-methoxyanilino]acetyl]piperidin-4-yl]prop-2-en-1-one (PubChem CID 134599273) has the molecular formula C23H24Cl2N2O3 and a molecular weight of 447.36 g/mol. Its IUPAC name is 1-[1-[2-[4-chloro-5-(4-chlorophenyl)-2-methoxyanilino]acetyl]piperidin-4-yl]prop-2-en-1-one.
| Compound Name | 1-[1-[2-[4-chloro-5-(4-chlorophenyl)-2-methoxyanilino]acetyl]piperidin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 134599273 |
| Molecular Formula | C23H24Cl2N2O3 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 1-[1-[2-[4-chloro-5-(4-chlorophenyl)-2-methoxyanilino]acetyl]piperidin-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)C1CCN(C(=O)CNc2cc(-c3ccc(Cl)cc3)c(Cl)cc2OC)CC1 |
| InChI | InChI=1S/C23H24Cl2N2O3/c1-3-21(28)16-8-10-27(11-9-16)23(29)14-26-20-12-18(19(25)13-22(20)30-2)15-4-6-17(24)7-5-15/h3-7,12-13,16,26H,1,8-11,14H2,2H3 |
| InChIKey | WDYYHASVHJERCU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|