C25H25Cl3N2O3 — CID 159204080
3-[4-chloro-5-(2,5-dichlorophenyl)-2-methoxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one (PubChem CID 159204080) has the molecular formula C25H25Cl3N2O3 and a molecular weight of 507.85 g/mol. Its IUPAC name is 3-[4-chloro-5-(2,5-dichlorophenyl)-2-methoxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one.
| Compound Name | 3-[4-chloro-5-(2,5-dichlorophenyl)-2-methoxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 159204080 |
| Molecular Formula | C25H25Cl3N2O3 |
| Molecular Weight | 507.85 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 3-[4-chloro-5-(2,5-dichlorophenyl)-2-methoxyphenyl]-1-(5-prop-2-enoyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)propan-1-one |
| SMILES | C=CC(=O)N1CC2CN(C(=O)CCc3cc(-c4cc(Cl)ccc4Cl)c(Cl)cc3OC)CC2C1 |
| InChI | InChI=1S/C25H25Cl3N2O3/c1-3-24(31)29-11-16-13-30(14-17(16)12-29)25(32)7-4-15-8-19(22(28)10-23(15)33-2)20-9-18(26)5-6-21(20)27/h3,5-6,8-10,16-17H,1,4,7,11-14H2,2H3 |
| InChIKey | KPQPAAPLPNVHKG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.85 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|