C21H27N4O3+ — CID 147854485
2-[1-cyclohexyl-4-[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-5-yl]ethyl-methyloxidanium (PubChem CID 147854485) has the molecular formula C21H27N4O3+ and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[1-cyclohexyl-4-[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-5-yl]ethyl-methyloxidanium.
| Compound Name | 2-[1-cyclohexyl-4-[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-5-yl]ethyl-methyloxidanium |
|---|---|
| PubChem CID | 147854485 |
| Molecular Formula | C21H27N4O3+ |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-[1-cyclohexyl-4-[3-[4-(hydroxymethyl)phenyl]-1,2,4-oxadiazol-5-yl]pyrazol-5-yl]ethyl-methyloxidanium |
| SMILES | C[OH+]CCc1c(-c2nc(-c3ccc(CO)cc3)no2)cnn1C1CCCCC1 |
| InChI | InChI=1S/C21H26N4O3/c1-27-12-11-19-18(13-22-25(19)17-5-3-2-4-6-17)21-23-20(24-28-21)16-9-7-15(14-26)8-10-16/h7-10,13,17,26H,2-6,11-12,14H2,1H3/p+1 |
| InChIKey | HVLXSAMBYAILJL-UHFFFAOYSA-O |
| XLogP | 3.30 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|