C26H33ClN4O6S — CID 147863983
[4-[2-chloro-3-(ethoxymethyl)-4-methylsulfonylbenzoyl]-3-cyclopropyl-1-propan-2-ylpyrazol-5-yl] 3-amino-2-(methyliminomethyl)but-2-enoate (PubChem CID 147863983) has the molecular formula C26H33ClN4O6S and a molecular weight of 565.09 g/mol. Its IUPAC name is [4-[2-chloro-3-(ethoxymethyl)-4-methylsulfonylbenzoyl]-3-cyclopropyl-1-propan-2-ylpyrazol-5-yl] 3-amino-2-(methyliminomethyl)but-2-enoate.
| Compound Name | [4-[2-chloro-3-(ethoxymethyl)-4-methylsulfonylbenzoyl]-3-cyclopropyl-1-propan-2-ylpyrazol-5-yl] 3-amino-2-(methyliminomethyl)but-2-enoate |
|---|---|
| PubChem CID | 147863983 |
| Molecular Formula | C26H33ClN4O6S |
| Molecular Weight | 565.09 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | [4-[2-chloro-3-(ethoxymethyl)-4-methylsulfonylbenzoyl]-3-cyclopropyl-1-propan-2-ylpyrazol-5-yl] 3-amino-2-(methyliminomethyl)but-2-enoate |
| SMILES | CCOCc1c(S(C)(=O)=O)ccc(C(=O)c2c(C3CC3)nn(C(C)C)c2OC(=O)C(/C=N/C)=C(C)N)c1Cl |
| InChI | InChI=1S/C26H33ClN4O6S/c1-7-36-13-19-20(38(6,34)35)11-10-17(22(19)27)24(32)21-23(16-8-9-16)30-31(14(2)3)25(21)37-26(33)18(12-29-5)15(4)28/h10-12,14,16H,7-9,13,28H2,1-6H3/b18-15?,29-12+ |
| InChIKey | DPUQOPQNRURZPQ-PQHGMSCUSA-N |
| XLogP | 4.00 |
| TPSA | 142.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.09 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|