C8H11NO3 — CID 14787239
ethyl 5-ethyl-1,2-oxazole-4-carboxylate (PubChem CID 14787239) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is ethyl 5-ethyl-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-ethyl-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 14787239 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | ethyl 5-ethyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnoc1CC |
| InChI | InChI=1S/C8H11NO3/c1-3-7-6(5-9-12-7)8(10)11-4-2/h5H,3-4H2,1-2H3 |
| InChIKey | AQURYAAEMBBAOL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |