C7H8ClNO3 — CID 75487595
ethyl 5-(chloromethyl)-1,2-oxazole-4-carboxylate (PubChem CID 75487595) has the molecular formula C7H8ClNO3 and a molecular weight of 189.60 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1,2-oxazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 75487595 |
| Molecular Formula | C7H8ClNO3 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | ethyl 5-(chloromethyl)-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnoc1CCl |
| InChI | InChI=1S/C7H8ClNO3/c1-2-11-7(10)5-4-9-12-6(5)3-8/h4H,2-3H2,1H3 |
| InChIKey | ZJJNASDETDEEII-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|