C30H33N9O2 — CID 147899002
1-[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(methylamino)ethanone (PubChem CID 147899002) has the molecular formula C30H33N9O2 and a molecular weight of 551.66 g/mol. Its IUPAC name is 1-[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(methylamino)ethanone.
| Compound Name | 1-[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 147899002 |
| Molecular Formula | C30H33N9O2 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 1-[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-2-(methylamino)ethanone |
| SMILES | CNCC(=O)N1CCN2CC(c3cc(-c4ccc5cn(Cc6ccccc6)nc5c4)c4c(N)ncnn34)OCC2C1 |
| InChI | InChI=1S/C30H33N9O2/c1-32-13-28(40)37-10-9-36-17-27(41-18-23(36)16-37)26-12-24(29-30(31)33-19-34-39(26)29)21-7-8-22-15-38(35-25(22)11-21)14-20-5-3-2-4-6-20/h2-8,11-12,15,19,23,27,32H,9-10,13-14,16-18H2,1H3,(H2,31,33,34) |
| InChIKey | IDWWBCDIWJCAGO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |