C30H32N8O2 — CID 71133954
(1S,4S)-5-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 71133954) has the molecular formula C30H32N8O2 and a molecular weight of 536.64 g/mol. Its IUPAC name is (1S,4S)-5-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,4S)-5-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 71133954 |
| Molecular Formula | C30H32N8O2 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (1S,4S)-5-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Nc1ncnn2c(CCCCN3C[C@@H]4C[C@H]3CN4C(=O)O)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C30H32N8O2/c31-29-28-26(21-9-10-22-16-36(34-27(22)12-21)15-20-6-2-1-3-7-20)14-23(38(28)33-19-32-29)8-4-5-11-35-17-25-13-24(35)18-37(25)30(39)40/h1-3,6-7,9-10,12,14,16,19,24-25H,4-5,8,11,13,15,17-18H2,(H,39,40)(H2,31,32,33)/t24-,25-/m0/s1 |
| InChIKey | OAICLFVRHXYRGI-DQEYMECFSA-N |
| XLogP | 4.14 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|