C32H34N8 — CID 58529446
5-(2-benzylindazol-6-yl)-7-[4-[ethyl(pyridin-4-ylmethyl)amino]butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529446) has the molecular formula C32H34N8 and a molecular weight of 530.68 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)-7-[4-[ethyl(pyridin-4-ylmethyl)amino]butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)-7-[4-[ethyl(pyridin-4-ylmethyl)amino]butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529446 |
| Molecular Formula | C32H34N8 |
| Molecular Weight | 530.68 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)-7-[4-[ethyl(pyridin-4-ylmethyl)amino]butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CCN(CCCCc1cc(-c2ccc3cn(Cc4ccccc4)nc3c2)c2c(N)ncnn12)Cc1ccncc1 |
| InChI | InChI=1S/C32H34N8/c1-2-38(20-25-13-15-34-16-14-25)17-7-6-10-28-19-29(31-32(33)35-23-36-40(28)31)26-11-12-27-22-39(37-30(27)18-26)21-24-8-4-3-5-9-24/h3-5,8-9,11-16,18-19,22-23H,2,6-7,10,17,20-21H2,1H3,(H2,33,35,36) |
| InChIKey | DBOVGUSYMAONNU-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.68 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|