C28H23N7O — CID 89307905
N-[[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methyl]formamide (PubChem CID 89307905) has the molecular formula C28H23N7O and a molecular weight of 473.54 g/mol. Its IUPAC name is N-[[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methyl]formamide.
| Compound Name | N-[[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methyl]formamide |
|---|---|
| PubChem CID | 89307905 |
| Molecular Formula | C28H23N7O |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methyl]formamide |
| SMILES | Nc1ncnn2c(-c3ccc(CNC=O)cc3)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C28H23N7O/c29-28-27-24(13-26(35(27)32-17-31-28)21-8-6-19(7-9-21)14-30-18-36)22-10-11-23-16-34(33-25(23)12-22)15-20-4-2-1-3-5-20/h1-13,16-18H,14-15H2,(H,30,36)(H2,29,31,32) |
| InChIKey | MRPQWNDNJJEEJX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|