C20H16N6 — CID 58529351
5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529351) has the molecular formula C20H16N6 and a molecular weight of 340.39 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529351 |
| Molecular Formula | C20H16N6 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2ccc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C20H16N6/c21-20-19-17(8-9-26(19)23-13-22-20)15-6-7-16-12-25(24-18(16)10-15)11-14-4-2-1-3-5-14/h1-10,12-13H,11H2,(H2,21,22,23) |
| InChIKey | LOXXXYUTKPESBS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |