C28H26N7S+ — CID 143458870
[[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methylamino]-methylsulfanium (PubChem CID 143458870) has the molecular formula C28H26N7S+ and a molecular weight of 492.63 g/mol. Its IUPAC name is [[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methylamino]-methylsulfanium.
| Compound Name | [[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methylamino]-methylsulfanium |
|---|---|
| PubChem CID | 143458870 |
| Molecular Formula | C28H26N7S+ |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | [[3-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methylamino]-methylsulfanium |
| SMILES | C[SH+]NCc1cccc(-c2cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c3c(N)ncnn23)c1 |
| InChI | InChI=1S/C28H25N7S/c1-36-32-15-20-8-5-9-22(12-20)26-14-24(27-28(29)30-18-31-35(26)27)21-10-11-23-17-34(33-25(23)13-21)16-19-6-3-2-4-7-19/h2-14,17-18,32H,15-16H2,1H3,(H2,29,30,31)/p+1 |
| InChIKey | IILAZTLJWKTVSZ-UHFFFAOYSA-O |
| XLogP | 4.49 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|