C29H25N7 — CID 58529336
5-(2-benzylindazol-6-yl)-7-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529336) has the molecular formula C29H25N7 and a molecular weight of 471.57 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)-7-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)-7-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529336 |
| Molecular Formula | C29H25N7 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)-7-(1,2,3,4-tetrahydroisoquinolin-7-yl)pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(-c3ccc4c(c3)CNCC4)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C29H25N7/c30-29-28-25(21-7-9-23-17-35(34-26(23)13-21)16-19-4-2-1-3-5-19)14-27(36(28)33-18-32-29)22-8-6-20-10-11-31-15-24(20)12-22/h1-9,12-14,17-18,31H,10-11,15-16H2,(H2,30,32,33) |
| InChIKey | ANLALGVMJPADSQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |