C29H31F2N7 — CID 58529397
5-(2-benzylindazol-6-yl)-7-[4-(4,4-difluoropiperidin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529397) has the molecular formula C29H31F2N7 and a molecular weight of 515.61 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)-7-[4-(4,4-difluoropiperidin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)-7-[4-(4,4-difluoropiperidin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529397 |
| Molecular Formula | C29H31F2N7 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)-7-[4-(4,4-difluoropiperidin-1-yl)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(CCCCN3CCC(F)(F)CC3)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C29H31F2N7/c30-29(31)11-14-36(15-12-29)13-5-4-8-24-17-25(27-28(32)33-20-34-38(24)27)22-9-10-23-19-37(35-26(23)16-22)18-21-6-2-1-3-7-21/h1-3,6-7,9-10,16-17,19-20H,4-5,8,11-15,18H2,(H2,32,33,34) |
| InChIKey | XCBVANZBZDQBCU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 77.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|