C29H33N7O — CID 58529724
(3R)-1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol (PubChem CID 58529724) has the molecular formula C29H33N7O and a molecular weight of 495.63 g/mol. Its IUPAC name is (3R)-1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol.
| Compound Name | (3R)-1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol |
|---|---|
| PubChem CID | 58529724 |
| Molecular Formula | C29H33N7O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (3R)-1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol |
| SMILES | Nc1ncnn2c(CCCCN3CCC[C@@H](O)C3)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C29H33N7O/c30-29-28-26(22-11-12-23-18-35(33-27(23)15-22)17-21-7-2-1-3-8-21)16-24(36(28)32-20-31-29)9-4-5-13-34-14-6-10-25(37)19-34/h1-3,7-8,11-12,15-16,18,20,25,37H,4-6,9-10,13-14,17,19H2,(H2,30,31,32)/t25-/m1/s1 |
| InChIKey | FVBBGGCHZJXNLE-RUZDIDTESA-N |
| XLogP | 4.16 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|