C31H37N7O — CID 58529903
2-[1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-4-yl]ethanol (PubChem CID 58529903) has the molecular formula C31H37N7O and a molecular weight of 523.69 g/mol. Its IUPAC name is 2-[1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-4-yl]ethanol.
| Compound Name | 2-[1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-4-yl]ethanol |
|---|---|
| PubChem CID | 58529903 |
| Molecular Formula | C31H37N7O |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | 2-[1-[4-[4-amino-5-(2-benzylindazol-6-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-4-yl]ethanol |
| SMILES | Nc1ncnn2c(CCCCN3CCC(CCO)CC3)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C31H37N7O/c32-31-30-28(25-9-10-26-21-37(35-29(26)18-25)20-24-6-2-1-3-7-24)19-27(38(30)34-22-33-31)8-4-5-14-36-15-11-23(12-16-36)13-17-39/h1-3,6-7,9-10,18-19,21-23,39H,4-5,8,11-17,20H2,(H2,32,33,34) |
| InChIKey | WPOLNLJEBOHOLQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|