C31H38N8 — CID 58529608
5-(2-benzylindazol-6-yl)-7-[4-(2-piperidin-1-ylethylamino)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 58529608) has the molecular formula C31H38N8 and a molecular weight of 522.70 g/mol. Its IUPAC name is 5-(2-benzylindazol-6-yl)-7-[4-(2-piperidin-1-ylethylamino)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-(2-benzylindazol-6-yl)-7-[4-(2-piperidin-1-ylethylamino)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 58529608 |
| Molecular Formula | C31H38N8 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 5-(2-benzylindazol-6-yl)-7-[4-(2-piperidin-1-ylethylamino)butyl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c(CCCCNCCN3CCCCC3)cc(-c3ccc4cn(Cc5ccccc5)nc4c3)c12 |
| InChI | InChI=1S/C31H38N8/c32-31-30-28(25-12-13-26-22-38(36-29(26)19-25)21-24-9-3-1-4-10-24)20-27(39(30)35-23-34-31)11-5-6-14-33-15-18-37-16-7-2-8-17-37/h1,3-4,9-10,12-13,19-20,22-23,33H,2,5-8,11,14-18,21H2,(H2,32,34,35) |
| InChIKey | IIGXTELLNVCDFR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|