C27H25F3N8O — CID 58529503
1-[4-[[4-amino-5-(2-benzylindazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 58529503) has the molecular formula C27H25F3N8O and a molecular weight of 534.55 g/mol. Its IUPAC name is 1-[4-[[4-amino-5-(2-benzylindazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-[[4-amino-5-(2-benzylindazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 58529503 |
| Molecular Formula | C27H25F3N8O |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[4-[[4-amino-5-(2-benzylindazol-5-yl)pyrrolo[2,1-f][1,2,4]triazin-7-yl]methyl]piperazin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | Nc1ncnn2c(CN3CCN(C(=O)C(F)(F)F)CC3)cc(-c3ccc4nn(Cc5ccccc5)cc4c3)c12 |
| InChI | InChI=1S/C27H25F3N8O/c28-27(29,30)26(39)36-10-8-35(9-11-36)16-21-13-22(24-25(31)32-17-33-38(21)24)19-6-7-23-20(12-19)15-37(34-23)14-18-4-2-1-3-5-18/h1-7,12-13,15,17H,8-11,14,16H2,(H2,31,32,33) |
| InChIKey | YYDHWCOIBPVAPW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |