C20H20N2O3Se — CID 14790351
ethyl (5Z)-5-[(4-ethoxyphenyl)methylidene]-4-phenyl-1,3,4-selenadiazole-2-carboxylate (PubChem CID 14790351) has the molecular formula C20H20N2O3Se and a molecular weight of 415.35 g/mol. Its IUPAC name is ethyl (5Z)-5-[(4-ethoxyphenyl)methylidene]-4-phenyl-1,3,4-selenadiazole-2-carboxylate.
| Compound Name | ethyl (5Z)-5-[(4-ethoxyphenyl)methylidene]-4-phenyl-1,3,4-selenadiazole-2-carboxylate |
|---|---|
| PubChem CID | 14790351 |
| Molecular Formula | C20H20N2O3Se |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | ethyl (5Z)-5-[(4-ethoxyphenyl)methylidene]-4-phenyl-1,3,4-selenadiazole-2-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)/C(=C/c2ccc(OCC)cc2)[Se]1 |
| InChI | InChI=1S/C20H20N2O3Se/c1-3-24-17-12-10-15(11-13-17)14-18-22(16-8-6-5-7-9-16)21-19(26-18)20(23)25-4-2/h5-14H,3-4H2,1-2H3/b18-14- |
| InChIKey | FSGQULQDBWYCKS-JXAWBTAJSA-N |
| XLogP | 3.48 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|