C18H16N2O2Se — CID 14944003
ethyl (5Z)-5-benzylidene-4-phenyl-1,3,4-selenadiazole-2-carboxylate (PubChem CID 14944003) has the molecular formula C18H16N2O2Se and a molecular weight of 371.30 g/mol. Its IUPAC name is ethyl (5Z)-5-benzylidene-4-phenyl-1,3,4-selenadiazole-2-carboxylate.
| Compound Name | ethyl (5Z)-5-benzylidene-4-phenyl-1,3,4-selenadiazole-2-carboxylate |
|---|---|
| PubChem CID | 14944003 |
| Molecular Formula | C18H16N2O2Se |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | ethyl (5Z)-5-benzylidene-4-phenyl-1,3,4-selenadiazole-2-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)/C(=C/c2ccccc2)[Se]1 |
| InChI | InChI=1S/C18H16N2O2Se/c1-2-22-18(21)17-19-20(15-11-7-4-8-12-15)16(23-17)13-14-9-5-3-6-10-14/h3-13H,2H2,1H3/b16-13- |
| InChIKey | NNJRAIRDUDZACK-SSZFMOIBSA-N |
| XLogP | 3.09 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|