C13H22IN3O2 — CID 147930647
N-[3-(ethylamino)-3-methylbutyl]-5-(iodomethyl)-4-methyl-1,2-oxazole-3-carboxamide (PubChem CID 147930647) has the molecular formula C13H22IN3O2 and a molecular weight of 379.24 g/mol. Its IUPAC name is N-[3-(ethylamino)-3-methylbutyl]-5-(iodomethyl)-4-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-(ethylamino)-3-methylbutyl]-5-(iodomethyl)-4-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 147930647 |
| Molecular Formula | C13H22IN3O2 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-[3-(ethylamino)-3-methylbutyl]-5-(iodomethyl)-4-methyl-1,2-oxazole-3-carboxamide |
| SMILES | CCNC(C)(C)CCNC(=O)c1noc(CI)c1C |
| InChI | InChI=1S/C13H22IN3O2/c1-5-16-13(3,4)6-7-15-12(18)11-9(2)10(8-14)19-17-11/h16H,5-8H2,1-4H3,(H,15,18) |
| InChIKey | IJULEVJWUZEPGM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|