C19H34N2O2 — CID 160612046
5-ethyl-4-methyl-N-(3-methyl-3-propyloctan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 160612046) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 5-ethyl-4-methyl-N-(3-methyl-3-propyloctan-2-yl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-ethyl-4-methyl-N-(3-methyl-3-propyloctan-2-yl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 160612046 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 5-ethyl-4-methyl-N-(3-methyl-3-propyloctan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CCCCCC(C)(CCC)C(C)NC(=O)c1noc(CC)c1C |
| InChI | InChI=1S/C19H34N2O2/c1-7-10-11-13-19(6,12-8-2)15(5)20-18(22)17-14(4)16(9-3)23-21-17/h15H,7-13H2,1-6H3,(H,20,22) |
| InChIKey | SFXBHHUKQRTHFI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|