C19H17N3S — CID 147935865
8-methyl-N-[(1S)-1-phenylethyl]thieno[2,3-h]quinazolin-2-amine (PubChem CID 147935865) has the molecular formula C19H17N3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 8-methyl-N-[(1S)-1-phenylethyl]thieno[2,3-h]quinazolin-2-amine.
| Compound Name | 8-methyl-N-[(1S)-1-phenylethyl]thieno[2,3-h]quinazolin-2-amine |
|---|---|
| PubChem CID | 147935865 |
| Molecular Formula | C19H17N3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 8-methyl-N-[(1S)-1-phenylethyl]thieno[2,3-h]quinazolin-2-amine |
| SMILES | Cc1cc2c(ccc3cnc(N[C@@H](C)c4ccccc4)nc32)s1 |
| InChI | InChI=1S/C19H17N3S/c1-12-10-16-17(23-12)9-8-15-11-20-19(22-18(15)16)21-13(2)14-6-4-3-5-7-14/h3-11,13H,1-2H3,(H,20,21,22)/t13-/m0/s1 |
| InChIKey | IKUCOENOBFZCFG-ZDUSSCGKSA-N |
| XLogP | 5.33 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |