C22H23Cl3N2 — CID 147941472
8-chloro-5-[2-(2,4-dichlorophenyl)-2-methylpropyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 147941472) has the molecular formula C22H23Cl3N2 and a molecular weight of 421.80 g/mol. Its IUPAC name is 8-chloro-5-[2-(2,4-dichlorophenyl)-2-methylpropyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-chloro-5-[2-(2,4-dichlorophenyl)-2-methylpropyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 147941472 |
| Molecular Formula | C22H23Cl3N2 |
| Molecular Weight | 421.80 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 8-chloro-5-[2-(2,4-dichlorophenyl)-2-methylpropyl]-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CN1CCc2c(c3cc(Cl)ccc3n2CC(C)(C)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C22H23Cl3N2/c1-22(2,18-6-4-15(24)11-19(18)25)13-27-20-7-5-14(23)10-16(20)17-12-26(3)9-8-21(17)27/h4-7,10-11H,8-9,12-13H2,1-3H3 |
| InChIKey | ILVHEXIZAWYXKU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.80 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|