C22H20ClF3N2O2 — CID 126486158
4-[2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]-2-(trifluoromethyl)benzaldehyde (PubChem CID 126486158) has the molecular formula C22H20ClF3N2O2 and a molecular weight of 436.86 g/mol. Its IUPAC name is 4-[2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]-2-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-[2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]-2-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 126486158 |
| Molecular Formula | C22H20ClF3N2O2 |
| Molecular Weight | 436.86 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-[2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-hydroxyethyl]-2-(trifluoromethyl)benzaldehyde |
| SMILES | CN1CCc2c(c3cc(Cl)ccc3n2CC(O)c2ccc(C=O)c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C22H20ClF3N2O2/c1-27-7-6-20-17(10-27)16-9-15(23)4-5-19(16)28(20)11-21(30)13-2-3-14(12-29)18(8-13)22(24,25)26/h2-5,8-9,12,21,30H,6-7,10-11H2,1H3 |
| InChIKey | ZHPZAXQUZZSKJH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.86 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|