C21H24ClFN2O — CID 161327447
2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-1-(2-fluorophenyl)ethanol;methane (PubChem CID 161327447) has the molecular formula C21H24ClFN2O and a molecular weight of 374.89 g/mol. Its IUPAC name is 2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-1-(2-fluorophenyl)ethanol;methane.
| Compound Name | 2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-1-(2-fluorophenyl)ethanol;methane |
|---|---|
| PubChem CID | 161327447 |
| Molecular Formula | C21H24ClFN2O |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-(6-chloro-2-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)-1-(2-fluorophenyl)ethanol;methane |
| SMILES | C.CN1CCc2c(n(CC(O)c3ccccc3F)c3ccc(Cl)cc23)C1 |
| InChI | InChI=1S/C20H20ClFN2O.CH4/c1-23-9-8-14-16-10-13(21)6-7-18(16)24(19(14)11-23)12-20(25)15-4-2-3-5-17(15)22;/h2-7,10,20,25H,8-9,11-12H2,1H3;1H4 |
| InChIKey | VKYLQQYATSKCLC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|