C21H20ClFN2O — CID 59368241
2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(4-fluorophenyl)ethanone (PubChem CID 59368241) has the molecular formula C21H20ClFN2O and a molecular weight of 370.86 g/mol. Its IUPAC name is 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 59368241 |
| Molecular Formula | C21H20ClFN2O |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 2-(9-chloro-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indol-6-yl)-1-(4-fluorophenyl)ethanone |
| SMILES | CN1CCc2c(n(CC(=O)c3ccc(F)cc3)c3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C21H20ClFN2O/c1-24-10-8-17-18-12-15(22)4-7-19(18)25(20(17)9-11-24)13-21(26)14-2-5-16(23)6-3-14/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | ITBGHEUTBFOAFI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|