C20H18ClFN2O — CID 87469443
2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-(4-fluorocyclohexa-1,2,3,5-tetraen-1-yl)ethanol (PubChem CID 87469443) has the molecular formula C20H18ClFN2O and a molecular weight of 356.83 g/mol. Its IUPAC name is 2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-(4-fluorocyclohexa-1,2,3,5-tetraen-1-yl)ethanol.
| Compound Name | 2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-(4-fluorocyclohexa-1,2,3,5-tetraen-1-yl)ethanol |
|---|---|
| PubChem CID | 87469443 |
| Molecular Formula | C20H18ClFN2O |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-1-(4-fluorocyclohexa-1,2,3,5-tetraen-1-yl)ethanol |
| SMILES | CN1CCc2c(c3cc(Cl)ccc3n2CC(O)C2=C=C=C(F)C=C2)C1 |
| InChI | InChI=1S/C20H18ClFN2O/c1-23-9-8-19-17(11-23)16-10-14(21)4-7-18(16)24(19)12-20(25)13-2-5-15(22)6-3-13/h2,4-5,7,10,20,25H,8-9,11-12H2,1H3 |
| InChIKey | RLCYNBJKKYHURX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|