C22H25ClN4O2 — CID 50942884
ethyl 4-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyrimidin-4-ylbutanoate (PubChem CID 50942884) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is ethyl 4-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyrimidin-4-ylbutanoate.
| Compound Name | ethyl 4-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyrimidin-4-ylbutanoate |
|---|---|
| PubChem CID | 50942884 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | ethyl 4-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3-pyrimidin-4-ylbutanoate |
| SMILES | CCOC(=O)CC(Cn1c2c(c3cc(Cl)ccc31)CN(C)CC2)c1ccncn1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-3-29-22(28)10-15(19-6-8-24-14-25-19)12-27-20-5-4-16(23)11-17(20)18-13-26(2)9-7-21(18)27/h4-6,8,11,14-15H,3,7,9-10,12-13H2,1-2H3 |
| InChIKey | JMUDNIVXUUPVJO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|