C26H35N3O2 — CID 158497005
tert-butyl 3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-4-ylpropanoate;methane (PubChem CID 158497005) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is tert-butyl 3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-4-ylpropanoate;methane.
| Compound Name | tert-butyl 3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-4-ylpropanoate;methane |
|---|---|
| PubChem CID | 158497005 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | tert-butyl 3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-2-pyridin-4-ylpropanoate;methane |
| SMILES | C.Cc1ccc2c(c1)c1c(n2CC(C(=O)OC(C)(C)C)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C25H31N3O2.CH4/c1-17-6-7-22-19(14-17)21-15-27(5)13-10-23(21)28(22)16-20(18-8-11-26-12-9-18)24(29)30-25(2,3)4;/h6-9,11-12,14,20H,10,13,15-16H2,1-5H3;1H4 |
| InChIKey | HJKMXRFFMPNIJS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|