C26H35N3 — CID 151443430
5-(5,5-dimethyl-2-pyridin-4-ylhexyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 151443430) has the molecular formula C26H35N3 and a molecular weight of 389.59 g/mol. Its IUPAC name is 5-(5,5-dimethyl-2-pyridin-4-ylhexyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 5-(5,5-dimethyl-2-pyridin-4-ylhexyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 151443430 |
| Molecular Formula | C26H35N3 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 5-(5,5-dimethyl-2-pyridin-4-ylhexyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(CCC(C)(C)C)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C26H35N3/c1-19-6-7-24-22(16-19)23-18-28(5)15-11-25(23)29(24)17-21(8-12-26(2,3)4)20-9-13-27-14-10-20/h6-7,9-10,13-14,16,21H,8,11-12,15,17-18H2,1-5H3 |
| InChIKey | PEZQKCJLKBGUMJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|