C22H29N3O2S — CID 158396188
2,8-dimethyl-5-(2-methylsulfonyl-2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;methane (PubChem CID 158396188) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2,8-dimethyl-5-(2-methylsulfonyl-2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;methane.
| Compound Name | 2,8-dimethyl-5-(2-methylsulfonyl-2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;methane |
|---|---|
| PubChem CID | 158396188 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2,8-dimethyl-5-(2-methylsulfonyl-2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole;methane |
| SMILES | C.Cc1ccc2c(c1)c1c(n2CC(c2cccnc2)S(C)(=O)=O)CCN(C)C1 |
| InChI | InChI=1S/C21H25N3O2S.CH4/c1-15-6-7-19-17(11-15)18-13-23(2)10-8-20(18)24(19)14-21(27(3,25)26)16-5-4-9-22-12-16;/h4-7,9,11-12,21H,8,10,13-14H2,1-3H3;1H4 |
| InChIKey | GXOMYKIJWLGAQJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|