C25H36N4 — CID 158933310
4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N,N-dimethyl-3-pyridin-4-ylbutan-1-amine;methane (PubChem CID 158933310) has the molecular formula C25H36N4 and a molecular weight of 392.59 g/mol. Its IUPAC name is 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N,N-dimethyl-3-pyridin-4-ylbutan-1-amine;methane.
| Compound Name | 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N,N-dimethyl-3-pyridin-4-ylbutan-1-amine;methane |
|---|---|
| PubChem CID | 158933310 |
| Molecular Formula | C25H36N4 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 4-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N,N-dimethyl-3-pyridin-4-ylbutan-1-amine;methane |
| SMILES | C.Cc1ccc2c(c1)c1c(n2CC(CCN(C)C)c2ccncc2)CCN(C)C1 |
| InChI | InChI=1S/C24H32N4.CH4/c1-18-5-6-23-21(15-18)22-17-27(4)14-10-24(22)28(23)16-20(9-13-26(2)3)19-7-11-25-12-8-19;/h5-8,11-12,15,20H,9-10,13-14,16-17H2,1-4H3;1H4 |
| InChIKey | JJILFPKZIOCNJM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|