C22H28N2 — CID 143825900
5-(2-cyclohexa-1,3-dien-1-ylpropyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 143825900) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 5-(2-cyclohexa-1,3-dien-1-ylpropyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 5-(2-cyclohexa-1,3-dien-1-ylpropyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 143825900 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 5-(2-cyclohexa-1,3-dien-1-ylpropyl)-2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(C)C2=CC=CCC2)CCN(C)C1 |
| InChI | InChI=1S/C22H28N2/c1-16-9-10-21-19(13-16)20-15-23(3)12-11-22(20)24(21)14-17(2)18-7-5-4-6-8-18/h4-5,7,9-10,13,17H,6,8,11-12,14-15H2,1-3H3 |
| InChIKey | JRDSXWSTTXNAQE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|