C26H38N4O3 — CID 59161660
tert-butyl 4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanoylamino]piperidine-1-carboxylate (PubChem CID 59161660) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is tert-butyl 4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanoylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59161660 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | tert-butyl 4-[3-(2,8-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)propanoylamino]piperidine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)c1c(n2CCC(=O)NC2CCN(C(=O)OC(C)(C)C)CC2)CCN(C)C1 |
| InChI | InChI=1S/C26H38N4O3/c1-18-6-7-22-20(16-18)21-17-28(5)12-10-23(21)30(22)15-11-24(31)27-19-8-13-29(14-9-19)25(32)33-26(2,3)4/h6-7,16,19H,8-15,17H2,1-5H3,(H,27,31) |
| InChIKey | PVPKVLDVSTUHAR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|