C12H18FN3O2 — CID 147944654
methyl 2,4-diamino-5-(diethylamino)-3-fluorobenzoate (PubChem CID 147944654) has the molecular formula C12H18FN3O2 and a molecular weight of 255.29 g/mol. Its IUPAC name is methyl 2,4-diamino-5-(diethylamino)-3-fluorobenzoate.
| Compound Name | methyl 2,4-diamino-5-(diethylamino)-3-fluorobenzoate |
|---|---|
| PubChem CID | 147944654 |
| Molecular Formula | C12H18FN3O2 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | methyl 2,4-diamino-5-(diethylamino)-3-fluorobenzoate |
| SMILES | CCN(CC)c1cc(C(=O)OC)c(N)c(F)c1N |
| InChI | InChI=1S/C12H18FN3O2/c1-4-16(5-2)8-6-7(12(17)18-3)10(14)9(13)11(8)15/h6H,4-5,14-15H2,1-3H3 |
| InChIKey | IMKVWRDSJOLFRQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|