C19H18F4N2O5 — CID 162752336
methyl 2-amino-4-[4-(3-amino-2,6-difluoro-4-formylphenoxy)butoxy]-3,5-difluorobenzoate (PubChem CID 162752336) has the molecular formula C19H18F4N2O5 and a molecular weight of 430.35 g/mol. Its IUPAC name is methyl 2-amino-4-[4-(3-amino-2,6-difluoro-4-formylphenoxy)butoxy]-3,5-difluorobenzoate.
| Compound Name | methyl 2-amino-4-[4-(3-amino-2,6-difluoro-4-formylphenoxy)butoxy]-3,5-difluorobenzoate |
|---|---|
| PubChem CID | 162752336 |
| Molecular Formula | C19H18F4N2O5 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | methyl 2-amino-4-[4-(3-amino-2,6-difluoro-4-formylphenoxy)butoxy]-3,5-difluorobenzoate |
| SMILES | COC(=O)c1cc(F)c(OCCCCOc2c(F)cc(C=O)c(N)c2F)c(F)c1N |
| InChI | InChI=1S/C19H18F4N2O5/c1-28-19(27)10-7-12(21)18(14(23)16(10)25)30-5-3-2-4-29-17-11(20)6-9(8-26)15(24)13(17)22/h6-8H,2-5,24-25H2,1H3 |
| InChIKey | LZDPRBIZHWSDNG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|