C9H7F3O3 — CID 163233297
2,3,5-trifluoro-4-(methoxymethoxy)benzaldehyde (PubChem CID 163233297) has the molecular formula C9H7F3O3 and a molecular weight of 220.15 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-(methoxymethoxy)benzaldehyde.
| Compound Name | 2,3,5-trifluoro-4-(methoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 163233297 |
| Molecular Formula | C9H7F3O3 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 2,3,5-trifluoro-4-(methoxymethoxy)benzaldehyde |
| SMILES | COCOc1c(F)cc(C=O)c(F)c1F |
| InChI | InChI=1S/C9H7F3O3/c1-14-4-15-9-6(10)2-5(3-13)7(11)8(9)12/h2-3H,4H2,1H3 |
| InChIKey | KFDAJLZBBSKRBJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|