C11H12F2O5 — CID 54157105
2,5-difluoro-3,4-bis(methoxymethoxy)benzaldehyde (PubChem CID 54157105) has the molecular formula C11H12F2O5 and a molecular weight of 262.21 g/mol. Its IUPAC name is 2,5-difluoro-3,4-bis(methoxymethoxy)benzaldehyde.
| Compound Name | 2,5-difluoro-3,4-bis(methoxymethoxy)benzaldehyde |
|---|---|
| PubChem CID | 54157105 |
| Molecular Formula | C11H12F2O5 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 2,5-difluoro-3,4-bis(methoxymethoxy)benzaldehyde |
| SMILES | COCOc1c(F)cc(C=O)c(F)c1OCOC |
| InChI | InChI=1S/C11H12F2O5/c1-15-5-17-10-8(12)3-7(4-14)9(13)11(10)18-6-16-2/h3-4H,5-6H2,1-2H3 |
| InChIKey | OLVOVAABHZZUEB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|