C9H7F3O4 — CID 164892738
2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid (PubChem CID 164892738) has the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. Its IUPAC name is 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid.
| Compound Name | 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid |
|---|---|
| PubChem CID | 164892738 |
| Molecular Formula | C9H7F3O4 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid |
| SMILES | COCOc1c(F)cc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C9H7F3O4/c1-15-3-16-8-5(11)2-4(10)6(7(8)12)9(13)14/h2H,3H2,1H3,(H,13,14) |
| InChIKey | VEMDBEOESJBEHK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|