2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid

C9H7F3O4 — CID 164892738

IUPAC2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid
SMILESCOCOc1c(F)cc(F)c(C(=O)O)c1F
InChIInChI=1S/C9H7F3O4/c1-15-3-16-8-5(11)2-4(10)6(7(8)12)9(13)14/h2H,3H2,1H3,(H,13,14)
InChIKeyVEMDBEOESJBEHK-UHFFFAOYSA-N
MW236.14 g/mol
LogP1.78
Rot. Bonds4

About 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid

2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid (PubChem CID 164892738) has the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. Its IUPAC name is 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid.

Molecular Properties

Compound Name2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid
PubChem CID164892738
Molecular FormulaC9H7F3O4
Molecular Weight236.14 g/mol
Exact Mass236.03
IUPAC Name2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid
SMILESCOCOc1c(F)cc(F)c(C(=O)O)c1F
InChIInChI=1S/C9H7F3O4/c1-15-3-16-8-5(11)2-4(10)6(7(8)12)9(13)14/h2H,3H2,1H3,(H,13,14)
InChIKeyVEMDBEOESJBEHK-UHFFFAOYSA-N
XLogP1.78
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.14
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid?
The IUPAC name of 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid (CID 164892738) is 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid.
What is the SMILES notation for 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid?
The canonical SMILES for 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid is COCOc1c(F)cc(F)c(C(=O)O)c1F.
What is the InChIKey of 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid?
The InChIKey is VEMDBEOESJBEHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O4/c1-15-3-16-8-5(11)2-4(10)6(7(8)12)9(13)14/h2H,3H2,1H3,(H,13,14).
What are the key properties of 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid?
2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid has a molecular weight of 236.14 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trifluoro-3-(methoxymethoxy)benzoic acid is sourced from PubChem (CID 164892738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).