C33H32ClFN6O2 — CID 147966826
6-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one (PubChem CID 147966826) has the molecular formula C33H32ClFN6O2 and a molecular weight of 599.11 g/mol. Its IUPAC name is 6-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one.
| Compound Name | 6-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 147966826 |
| Molecular Formula | C33H32ClFN6O2 |
| Molecular Weight | 599.11 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 6-chloro-1-[2,4-di(propan-2-yl)-3-pyridinyl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1c(N2CCN(C(=O)C=C)CC2)c2cc(Cl)c(-c3ccccc3F)nc2n(-c2c(C(C)C)ccnc2C(C)C)c1=O |
| InChI | InChI=1S/C33H32ClFN6O2/c1-7-26(42)39-14-16-40(17-15-39)30-23-18-24(34)28(22-10-8-9-11-25(22)35)38-32(23)41(33(43)29(30)36-6)31-21(19(2)3)12-13-37-27(31)20(4)5/h7-13,18-20H,1,14-17H2,2-5H3 |
| InChIKey | IQOLGMOYRUKELB-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.11 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|