C32H31ClFN7O2 — CID 153292230
6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one (PubChem CID 153292230) has the molecular formula C32H31ClFN7O2 and a molecular weight of 600.10 g/mol. Its IUPAC name is 6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one.
| Compound Name | 6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 153292230 |
| Molecular Formula | C32H31ClFN7O2 |
| Molecular Weight | 600.10 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 6-chloro-1-[4,6-di(propan-2-yl)pyrimidin-5-yl]-7-(2-fluorophenyl)-3-isocyano-4-(4-prop-2-enoylpiperazin-1-yl)-1,8-naphthyridin-2-one |
| SMILES | [C-]#[N+]c1c(N2CCN(C(=O)C=C)CC2)c2cc(Cl)c(-c3ccccc3F)nc2n(-c2c(C(C)C)ncnc2C(C)C)c1=O |
| InChI | InChI=1S/C32H31ClFN7O2/c1-7-24(42)39-12-14-40(15-13-39)29-21-16-22(33)27(20-10-8-9-11-23(20)34)38-31(21)41(32(43)28(29)35-6)30-25(18(2)3)36-17-37-26(30)19(4)5/h7-11,16-19H,1,12-15H2,2-5H3 |
| InChIKey | NFMCBAJFJHBALY-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 88.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.10 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|