About 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane
1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane (PubChem CID 147979649) has the molecular formula C15H21F3N2
and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane.
Molecular Properties
| Compound Name | 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane |
| PubChem CID | 147979649 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane |
| SMILES | CC(C)c1ccc(C(F)(F)F)cc1N1CCCN(C)C1 |
| InChI | InChI=1S/C15H21F3N2/c1-11(2)13-6-5-12(15(16,17)18)9-14(13)20-8-4-7-19(3)10-20/h5-6,9,11H,4,7-8,10H2,1-3H3 |
| InChIKey | PCTGDPPLBZUCSS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane?
The IUPAC name of 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane (CID 147979649) is 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane.
What is the SMILES notation for 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane?
The canonical SMILES for 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane is CC(C)c1ccc(C(F)(F)F)cc1N1CCCN(C)C1.
What is the InChIKey of 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane?
The InChIKey is PCTGDPPLBZUCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F3N2/c1-11(2)13-6-5-12(15(16,17)18)9-14(13)20-8-4-7-19(3)10-20/h5-6,9,11H,4,7-8,10H2,1-3H3.
What are the key properties of 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane?
1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane has a molecular weight of 286.34 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[2-propan-2-yl-5-(trifluoromethyl)phenyl]-1,3-diazinane is sourced from PubChem (CID 147979649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).